C14H20Cl2IN3O2 — CID 111306184
methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111306184) has the molecular formula C14H20Cl2IN3O2 and a molecular weight of 460.14 g/mol. Its IUPAC name is methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111306184 |
| Molecular Formula | C14H20Cl2IN3O2 |
| Molecular Weight | 460.14 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | methyl 3-[[N-[(3,4-dichlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C14H19Cl2N3O2.HI/c1-17-14(18-7-6-13(20)21-3)19(2)9-10-4-5-11(15)12(16)8-10;/h4-5,8H,6-7,9H2,1-3H3,(H,17,18);1H |
| InChIKey | APQQSENQIODPBX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|