C17H21Cl2IN4 — CID 111306058
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111306058) has the molecular formula C17H21Cl2IN4 and a molecular weight of 479.19 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306058 |
| Molecular Formula | C17H21Cl2IN4 |
| Molecular Weight | 479.19 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccn1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C17H20Cl2N4.HI/c1-20-17(22-10-8-14-5-3-4-9-21-14)23(2)12-13-6-7-15(18)16(19)11-13;/h3-7,9,11H,8,10,12H2,1-2H3,(H,20,22);1H |
| InChIKey | UDHIDPSOPQFQPM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|