C17H21ClN4 — CID 111293499
1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111293499) has the molecular formula C17H21ClN4 and a molecular weight of 316.84 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111293499 |
| Molecular Formula | C17H21ClN4 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccn1)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4/c1-19-17(21-12-10-16-5-3-4-11-20-16)22(2)13-14-6-8-15(18)9-7-14/h3-9,11H,10,12-13H2,1-2H3,(H,19,21) |
| InChIKey | WQMOEZKXJZTXRZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|