C17H21ClN4S — CID 111192944
1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192944) has the molecular formula C17H21ClN4S and a molecular weight of 348.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192944 |
| Molecular Formula | C17H21ClN4S |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)NCCc1ccccn1 |
| InChI | InChI=1S/C17H21ClN4S/c1-19-17(21-11-9-15-4-2-3-10-20-15)22-12-13-23-16-7-5-14(18)6-8-16/h2-8,10H,9,11-13H2,1H3,(H2,19,21,22) |
| InChIKey | BILDDSMTIKAHBX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|