C14H18ClIN4OS — CID 75424993
1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide (PubChem CID 75424993) has the molecular formula C14H18ClIN4OS and a molecular weight of 452.75 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75424993 |
| Molecular Formula | C14H18ClIN4OS |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)NCc1ccon1.I |
| InChI | InChI=1S/C14H17ClN4OS.HI/c1-16-14(18-10-12-6-8-20-19-12)17-7-9-21-13-4-2-11(15)3-5-13;/h2-6,8H,7,9-10H2,1H3,(H2,16,17,18);1H |
| InChIKey | QCZZHWJDKKEWDW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|