C12H23IN4O3 — CID 111965280
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111965280) has the molecular formula C12H23IN4O3 and a molecular weight of 398.25 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111965280 |
| Molecular Formula | C12H23IN4O3 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)NCc1ccon1.I |
| InChI | InChI=1S/C12H22N4O3.HI/c1-13-12(15-10-11-4-7-19-16-11)14-5-3-6-18-9-8-17-2;/h4,7H,3,5-6,8-10H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | FRDBSRIQNRCTIC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|