C17H31IN4O3 — CID 111840158
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(6-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111840158) has the molecular formula C17H31IN4O3 and a molecular weight of 466.36 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(6-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(6-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111840158 |
| Molecular Formula | C17H31IN4O3 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(6-propoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCCOc1ccc(CN/C(=N/C)NCCCOCCOC)cn1.I |
| InChI | InChI=1S/C17H30N4O3.HI/c1-4-9-24-16-7-6-15(13-20-16)14-21-17(18-2)19-8-5-10-23-12-11-22-3;/h6-7,13H,4-5,8-12,14H2,1-3H3,(H2,18,19,21);1H |
| InChIKey | NGTIVEZAUQJIKI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|