C18H30F3IN4O3 — CID 111693343
1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111693343) has the molecular formula C18H30F3IN4O3 and a molecular weight of 534.36 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111693343 |
| Molecular Formula | C18H30F3IN4O3 |
| Molecular Weight | 534.36 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)NCc1ccc(OCC(F)(F)F)nc1.I |
| InChI | InChI=1S/C18H29F3N4O3.HI/c1-3-4-8-26-10-11-27-9-7-23-17(22-2)25-13-15-5-6-16(24-12-15)28-14-18(19,20)21;/h5-6,12H,3-4,7-11,13-14H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | OAMQZNOZSURCNF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|