C16H20F3N5OS — CID 111535502
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111535502) has the molecular formula C16H20F3N5OS and a molecular weight of 387.43 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111535502 |
| Molecular Formula | C16H20F3N5OS |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2ccc(OCC(F)(F)F)nc2)s1 |
| InChI | InChI=1S/C16H20F3N5OS/c1-3-12-8-22-14(26-12)9-24-15(20-2)23-7-11-4-5-13(21-6-11)25-10-16(17,18)19/h4-6,8H,3,7,9-10H2,1-2H3,(H2,20,23,24) |
| InChIKey | DKODPMOZBWTPEB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|