C16H20F3N5O2 — CID 109431377
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 109431377) has the molecular formula C16H20F3N5O2 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 109431377 |
| Molecular Formula | C16H20F3N5O2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)nc1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C16H20F3N5O2/c1-10-11(2)26-14(24-10)8-23-15(20-3)22-7-12-4-5-13(21-6-12)25-9-16(17,18)19/h4-6H,7-9H2,1-3H3,(H2,20,22,23) |
| InChIKey | BMJFMFVAUOHTPU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|