C18H18F6N4O — CID 111268061
2-methyl-1-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111268061) has the molecular formula C18H18F6N4O and a molecular weight of 420.36 g/mol. Its IUPAC name is 2-methyl-1-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111268061 |
| Molecular Formula | C18H18F6N4O |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-methyl-1-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)nc1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F6N4O/c1-25-16(27-8-12-3-2-4-14(7-12)18(22,23)24)28-10-13-5-6-15(26-9-13)29-11-17(19,20)21/h2-7,9H,8,10-11H2,1H3,(H2,25,27,28) |
| InChIKey | XYYYJZIROUPXOS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|