C18H20ClF3N4O — CID 111882203
1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111882203) has the molecular formula C18H20ClF3N4O and a molecular weight of 400.83 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111882203 |
| Molecular Formula | C18H20ClF3N4O |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccccc1Cl)NCc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C18H20ClF3N4O/c1-23-17(24-9-8-14-4-2-3-5-15(14)19)26-11-13-6-7-16(25-10-13)27-12-18(20,21)22/h2-7,10H,8-9,11-12H2,1H3,(H2,23,24,26) |
| InChIKey | QQVHYGRAFKRONW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|