C19H35IN6O2 — CID 111404878
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111404878) has the molecular formula C19H35IN6O2 and a molecular weight of 506.43 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111404878 |
| Molecular Formula | C19H35IN6O2 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)NCc1ccc(N2CCN(C)CC2)nc1.I |
| InChI | InChI=1S/C19H34N6O2.HI/c1-20-19(21-7-4-12-27-14-13-26-3)23-16-17-5-6-18(22-15-17)25-10-8-24(2)9-11-25;/h5-6,15H,4,7-14,16H2,1-3H3,(H2,20,21,23);1H |
| InChIKey | UEFTVVUXNQVOOC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|