C16H25F3N6 — CID 109471963
2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471963) has the molecular formula C16H25F3N6 and a molecular weight of 358.41 g/mol. Its IUPAC name is 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471963 |
| Molecular Formula | C16H25F3N6 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccc(N2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C16H25F3N6/c1-20-15(21-6-5-16(17,18)19)23-12-13-3-4-14(22-11-13)25-9-7-24(2)8-10-25/h3-4,11H,5-10,12H2,1-2H3,(H2,20,21,23) |
| InChIKey | JDYQTDMPLKMMAQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|