C23H33N7O — CID 111875213
N,N-dimethyl-4-[[[N'-methyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111875213) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111875213 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCc1ccc(N2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C23H33N7O/c1-24-23(26-15-18-5-8-20(9-6-18)22(31)28(2)3)27-17-19-7-10-21(25-16-19)30-13-11-29(4)12-14-30/h5-10,16H,11-15,17H2,1-4H3,(H2,24,26,27) |
| InChIKey | GLWWKGDAHBMUFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|