C26H40IN7 — CID 111411252
2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111411252) has the molecular formula C26H40IN7 and a molecular weight of 577.56 g/mol. Its IUPAC name is 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111411252 |
| Molecular Formula | C26H40IN7 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCCCC2)cc1)NCc1ccc(N2CCN(C)CC2)nc1.I |
| InChI | InChI=1S/C26H39N7.HI/c1-27-26(29-18-22-6-8-23(9-7-22)21-32-12-4-3-5-13-32)30-20-24-10-11-25(28-19-24)33-16-14-31(2)15-17-33;/h6-11,19H,3-5,12-18,20-21H2,1-2H3,(H2,27,29,30);1H |
| InChIKey | PVYAAIIZYRVWOX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|