C25H44IN7 — CID 111292642
2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111292642) has the molecular formula C25H44IN7 and a molecular weight of 569.58 g/mol. Its IUPAC name is 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111292642 |
| Molecular Formula | C25H44IN7 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 2-methyl-1-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCN(C)CC2)nc1)NCC1(N2CCCCC2)CCCCC1.I |
| InChI | InChI=1S/C25H43N7.HI/c1-26-24(29-21-25(11-5-3-6-12-25)32-13-7-4-8-14-32)28-20-22-9-10-23(27-19-22)31-17-15-30(2)16-18-31;/h9-10,19H,3-8,11-18,20-21H2,1-2H3,(H2,26,28,29);1H |
| InChIKey | FSEAJXPAVNETHV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|