C22H33IN6O — CID 111277500
2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111277500) has the molecular formula C22H33IN6O and a molecular weight of 524.45 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111277500 |
| Molecular Formula | C22H33IN6O |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc(C)cc1)NCc1ccc(N2CCN(C)CC2)nc1.I |
| InChI | InChI=1S/C22H32N6O.HI/c1-18-4-7-20(8-5-18)29-15-10-24-22(23-2)26-17-19-6-9-21(25-16-19)28-13-11-27(3)12-14-28;/h4-9,16H,10-15,17H2,1-3H3,(H2,23,24,26);1H |
| InChIKey | DPTALSCMYUMTHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|