C15H18ClN3S2 — CID 111258831
1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111258831) has the molecular formula C15H18ClN3S2 and a molecular weight of 339.92 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111258831 |
| Molecular Formula | C15H18ClN3S2 |
| Molecular Weight | 339.92 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)NCc1cccs1 |
| InChI | InChI=1S/C15H18ClN3S2/c1-17-15(19-11-14-3-2-9-20-14)18-8-10-21-13-6-4-12(16)5-7-13/h2-7,9H,8,10-11H2,1H3,(H2,17,18,19) |
| InChIKey | OQIHNQVPGJKLAP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|