C15H19ClIN3OS — CID 111259464
1-[2-(3-chlorophenoxy)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111259464) has the molecular formula C15H19ClIN3OS and a molecular weight of 451.76 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111259464 |
| Molecular Formula | C15H19ClIN3OS |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1cccc(Cl)c1)NCc1cccs1.I |
| InChI | InChI=1S/C15H18ClN3OS.HI/c1-17-15(19-11-14-6-3-9-21-14)18-7-8-20-13-5-2-4-12(16)10-13;/h2-6,9-10H,7-8,11H2,1H3,(H2,17,18,19);1H |
| InChIKey | CBSHMSIXYPNUBC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|