C16H21ClIN3S — CID 111349187
1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111349187) has the molecular formula C16H21ClIN3S and a molecular weight of 449.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111349187 |
| Molecular Formula | C16H21ClIN3S |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc(Cl)c1)NCCc1cccs1.I |
| InChI | InChI=1S/C16H20ClN3S.HI/c1-18-16(20-10-8-15-6-3-11-21-15)19-9-7-13-4-2-5-14(17)12-13;/h2-6,11-12H,7-10H2,1H3,(H2,18,19,20);1H |
| InChIKey | JCMNPECJQUIENX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|