C14H23ClIN3S — CID 111785810
1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111785810) has the molecular formula C14H23ClIN3S and a molecular weight of 427.78 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111785810 |
| Molecular Formula | C14H23ClIN3S |
| Molecular Weight | 427.78 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-(3-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCSC)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C14H22ClN3S.HI/c1-16-14(17-8-4-10-19-2)18-9-7-12-5-3-6-13(15)11-12;/h3,5-6,11H,4,7-10H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | JWYRSEGTGKVLPW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|