C17H29ClN4 — CID 111357830
1-[2-(3-chlorophenyl)ethyl]-3-[3-(diethylamino)propyl]-2-methylguanidine (PubChem CID 111357830) has the molecular formula C17H29ClN4 and a molecular weight of 324.90 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[3-(diethylamino)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[3-(diethylamino)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111357830 |
| Molecular Formula | C17H29ClN4 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[3-(diethylamino)propyl]-2-methylguanidine |
| SMILES | CCN(CC)CCCN/C(=N\C)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H29ClN4/c1-4-22(5-2)13-7-11-20-17(19-3)21-12-10-15-8-6-9-16(18)14-15/h6,8-9,14H,4-5,7,10-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | OTLCPESFGQPZIQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|