C20H37IN4 — CID 111648983
1-[4-(diethylamino)butyl]-3-[2-(3,5-dimethylphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111648983) has the molecular formula C20H37IN4 and a molecular weight of 460.45 g/mol. Its IUPAC name is 1-[4-(diethylamino)butyl]-3-[2-(3,5-dimethylphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[4-(diethylamino)butyl]-3-[2-(3,5-dimethylphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111648983 |
| Molecular Formula | C20H37IN4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-[4-(diethylamino)butyl]-3-[2-(3,5-dimethylphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCCN/C(=N\C)NCCc1cc(C)cc(C)c1.I |
| InChI | InChI=1S/C20H36N4.HI/c1-6-24(7-2)13-9-8-11-22-20(21-5)23-12-10-19-15-17(3)14-18(4)16-19;/h14-16H,6-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | DZBHHUHNADROAO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|