C19H33ClN4 — CID 110999501
1-[2-(3-chlorophenyl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine (PubChem CID 110999501) has the molecular formula C19H33ClN4 and a molecular weight of 352.95 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 110999501 |
| Molecular Formula | C19H33ClN4 |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[5-(diethylamino)pentan-2-yl]-2-methylguanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H33ClN4/c1-5-24(6-2)14-8-9-16(3)23-19(21-4)22-13-12-17-10-7-11-18(20)15-17/h7,10-11,15-16H,5-6,8-9,12-14H2,1-4H3,(H2,21,22,23) |
| InChIKey | RWWCJUUOUWDXKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|