C21H40IN5 — CID 110999062
1-[5-(diethylamino)pentan-2-yl]-3-[[3-[(dimethylamino)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110999062) has the molecular formula C21H40IN5 and a molecular weight of 489.49 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[3-[(dimethylamino)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[3-[(dimethylamino)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110999062 |
| Molecular Formula | C21H40IN5 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[3-[(dimethylamino)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1cccc(CN(C)C)c1.I |
| InChI | InChI=1S/C21H39N5.HI/c1-7-26(8-2)14-10-11-18(3)24-21(22-4)23-16-19-12-9-13-20(15-19)17-25(5)6;/h9,12-13,15,18H,7-8,10-11,14,16-17H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | WXIPHMJBOWPERR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|