C23H43IN4O — CID 110999396
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 110999396) has the molecular formula C23H43IN4O and a molecular weight of 518.53 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110999396 |
| Molecular Formula | C23H43IN4O |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1cccc(COC(C)(C)C)c1.I |
| InChI | InChI=1S/C23H42N4O.HI/c1-8-27(9-2)15-11-12-19(3)26-22(24-7)25-17-20-13-10-14-21(16-20)18-28-23(4,5)6;/h10,13-14,16,19H,8-9,11-12,15,17-18H2,1-7H3,(H2,24,25,26);1H |
| InChIKey | YWMRYGMZMIBIQX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|