C21H38N4O — CID 110997907
1-[5-(diethylamino)pentan-2-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 110997907) has the molecular formula C21H38N4O and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110997907 |
| Molecular Formula | C21H38N4O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[2-(ethoxymethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | CCOCc1ccccc1CN/C(=N/C)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C21H38N4O/c1-6-25(7-2)15-11-12-18(4)24-21(22-5)23-16-19-13-9-10-14-20(19)17-26-8-3/h9-10,13-14,18H,6-8,11-12,15-17H2,1-5H3,(H2,22,23,24) |
| InChIKey | SBFSTNXQXBJKMM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|