C26H40N4O — CID 110997887
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine (PubChem CID 110997887) has the molecular formula C26H40N4O and a molecular weight of 424.63 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110997887 |
| Molecular Formula | C26H40N4O |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1ccccc1COCc1ccccc1 |
| InChI | InChI=1S/C26H40N4O/c1-5-30(6-2)18-12-13-22(3)29-26(27-4)28-19-24-16-10-11-17-25(24)21-31-20-23-14-8-7-9-15-23/h7-11,14-17,22H,5-6,12-13,18-21H2,1-4H3,(H2,27,28,29) |
| InChIKey | PYAJIQIUECVRLO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|