C23H42N4O — CID 110999725
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[4-(2-phenylethoxy)butyl]guanidine (PubChem CID 110999725) has the molecular formula C23H42N4O and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[4-(2-phenylethoxy)butyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[4-(2-phenylethoxy)butyl]guanidine |
|---|---|
| PubChem CID | 110999725 |
| Molecular Formula | C23H42N4O |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.34 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[4-(2-phenylethoxy)butyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCCCOCCc1ccccc1 |
| InChI | InChI=1S/C23H42N4O/c1-5-27(6-2)18-12-13-21(3)26-23(24-4)25-17-10-11-19-28-20-16-22-14-8-7-9-15-22/h7-9,14-15,21H,5-6,10-13,16-20H2,1-4H3,(H2,24,25,26) |
| InChIKey | VPVBTWNMEDGVMY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|