C20H33F3N4O — CID 111000219
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111000219) has the molecular formula C20H33F3N4O and a molecular weight of 402.51 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111000219 |
| Molecular Formula | C20H33F3N4O |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C20H33F3N4O/c1-5-27(6-2)13-9-10-16(3)26-19(24-4)25-14-17-11-7-8-12-18(17)28-15-20(21,22)23/h7-8,11-12,16H,5-6,9-10,13-15H2,1-4H3,(H2,24,25,26) |
| InChIKey | JHEGCEFBJZHWKH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|