C22H37IN6 — CID 110997804
1-[5-(diethylamino)pentan-2-yl]-3-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110997804) has the molecular formula C22H37IN6 and a molecular weight of 512.48 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110997804 |
| Molecular Formula | C22H37IN6 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCc1cccc(Cn2ccnc2)c1.I |
| InChI | InChI=1S/C22H36N6.HI/c1-5-27(6-2)13-8-9-19(3)26-22(23-4)25-16-20-10-7-11-21(15-20)17-28-14-12-24-18-28;/h7,10-12,14-15,18-19H,5-6,8-9,13,16-17H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | AZWUDVHJBRSNME-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|