C23H30IN5 — CID 111172490
1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111172490) has the molecular formula C23H30IN5 and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111172490 |
| Molecular Formula | C23H30IN5 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(Cn2ccnc2)c1)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C23H29N5.HI/c1-19(11-12-20-7-4-3-5-8-20)27-23(24-2)26-16-21-9-6-10-22(15-21)17-28-14-13-25-18-28;/h3-10,13-15,18-19H,11-12,16-17H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | MIUAFNQYLUKAMW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|