C20H24N6 — CID 111192192
1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192192) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192192 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1cccc(Cn2ccnc2)c1 |
| InChI | InChI=1S/C20H24N6/c1-21-20(24-10-8-19-7-2-3-9-23-19)25-14-17-5-4-6-18(13-17)15-26-12-11-22-16-26/h2-7,9,11-13,16H,8,10,14-15H2,1H3,(H2,21,24,25) |
| InChIKey | IOIVZWBNZNNPIC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|