C12H15ClIN3S2 — CID 119131183
1-[(5-chlorothiophen-2-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119131183) has the molecular formula C12H15ClIN3S2 and a molecular weight of 427.76 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119131183 |
| Molecular Formula | C12H15ClIN3S2 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccs1)NCc1ccc(Cl)s1.I |
| InChI | InChI=1S/C12H14ClN3S2.HI/c1-14-12(15-7-9-3-2-6-17-9)16-8-10-4-5-11(13)18-10;/h2-6H,7-8H2,1H3,(H2,14,15,16);1H |
| InChIKey | CNCXVEGFOFUZHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|