C11H14N4S2 — CID 119131208
2-methyl-1-(1,3-thiazol-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 119131208) has the molecular formula C11H14N4S2 and a molecular weight of 266.40 g/mol. Its IUPAC name is 2-methyl-1-(1,3-thiazol-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-(1,3-thiazol-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119131208 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-methyl-1-(1,3-thiazol-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1cccs1)NCc1nccs1 |
| InChI | InChI=1S/C11H14N4S2/c1-12-11(14-7-9-3-2-5-16-9)15-8-10-13-4-6-17-10/h2-6H,7-8H2,1H3,(H2,12,14,15) |
| InChIKey | LHTWTZNPCPHOMB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|