C16H22ClIN4OS — CID 111372070
1-[2-(4-chlorophenyl)sulfanylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111372070) has the molecular formula C16H22ClIN4OS and a molecular weight of 480.80 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111372070 |
| Molecular Formula | C16H22ClIN4OS |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C16H21ClN4OS.HI/c1-11-12(2)22-15(21-11)10-20-16(18-3)19-8-9-23-14-6-4-13(17)5-7-14;/h4-7H,8-10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | RLYACFNGSRINHD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|