C14H18FIN4O — CID 111964524
1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111964524) has the molecular formula C14H18FIN4O and a molecular weight of 404.23 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111964524 |
| Molecular Formula | C14H18FIN4O |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)cc1)NCc1ccon1.I |
| InChI | InChI=1S/C14H17FN4O.HI/c1-16-14(18-10-13-7-9-20-19-13)17-8-6-11-2-4-12(15)5-3-11;/h2-5,7,9H,6,8,10H2,1H3,(H2,16,17,18);1H |
| InChIKey | LWJXLBMIUBRTAF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|