C14H17FN4O — CID 111965217
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine (PubChem CID 111965217) has the molecular formula C14H17FN4O and a molecular weight of 276.32 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111965217 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCc1cccc(F)c1)NCc1ccon1 |
| InChI | InChI=1S/C14H17FN4O/c1-16-14(18-10-13-6-8-20-19-13)17-7-5-11-3-2-4-12(15)9-11/h2-4,6,8-9H,5,7,10H2,1H3,(H2,16,17,18) |
| InChIKey | VEUGGUBAIXISQO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|