C14H16F3IN4O — CID 111965358
2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111965358) has the molecular formula C14H16F3IN4O and a molecular weight of 440.21 g/mol. Its IUPAC name is 2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111965358 |
| Molecular Formula | C14H16F3IN4O |
| Molecular Weight | 440.21 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-methyl-1-(1,2-oxazol-3-ylmethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(F)(F)F)cc1)NCc1ccon1.I |
| InChI | InChI=1S/C14H15F3N4O.HI/c1-18-13(20-9-12-6-7-22-21-12)19-8-10-2-4-11(5-3-10)14(15,16)17;/h2-7H,8-9H2,1H3,(H2,18,19,20);1H |
| InChIKey | FVBJUBIUXNSCIG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|