C13H15F3IN3 — CID 111419988
2-methyl-1-prop-2-ynyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111419988) has the molecular formula C13H15F3IN3 and a molecular weight of 397.18 g/mol. Its IUPAC name is 2-methyl-1-prop-2-ynyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-prop-2-ynyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111419988 |
| Molecular Formula | C13H15F3IN3 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-methyl-1-prop-2-ynyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C13H14F3N3.HI/c1-3-8-18-12(17-2)19-9-10-4-6-11(7-5-10)13(14,15)16;/h1,4-7H,8-9H2,2H3,(H2,17,18,19);1H |
| InChIKey | BNXVEWYVXIXYBT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|