C15H19F3IN3 — CID 136921127
1-ethyl-3-prop-2-ynyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 136921127) has the molecular formula C15H19F3IN3 and a molecular weight of 425.24 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-ynyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-prop-2-ynyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136921127 |
| Molecular Formula | C15H19F3IN3 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 1-ethyl-3-prop-2-ynyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CCc1ccc(C(F)(F)F)cc1)NCC.I |
| InChI | InChI=1S/C15H18F3N3.HI/c1-3-10-20-14(19-4-2)21-11-9-12-5-7-13(8-6-12)15(16,17)18;/h1,5-8H,4,9-11H2,2H3,(H2,19,20,21);1H |
| InChIKey | NLKCZOKNVGTXKQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|