C15H23F3IN3 — CID 111128476
2-methyl-1-pentyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111128476) has the molecular formula C15H23F3IN3 and a molecular weight of 429.27 g/mol. Its IUPAC name is 2-methyl-1-pentyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-pentyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111128476 |
| Molecular Formula | C15H23F3IN3 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-methyl-1-pentyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCCN/C(=N\C)NCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C15H22F3N3.HI/c1-3-4-5-10-20-14(19-2)21-11-12-6-8-13(9-7-12)15(16,17)18;/h6-9H,3-5,10-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | CYDSWHHAFNEEFO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|