C16H21FIN3O — CID 111228882
1-[2-(4-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111228882) has the molecular formula C16H21FIN3O and a molecular weight of 417.27 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111228882 |
| Molecular Formula | C16H21FIN3O |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)cc1)NCCc1ccco1.I |
| InChI | InChI=1S/C16H20FN3O.HI/c1-18-16(20-11-9-15-3-2-12-21-15)19-10-8-13-4-6-14(17)7-5-13;/h2-7,12H,8-11H2,1H3,(H2,18,19,20);1H |
| InChIKey | RATLXLWKCPMZEH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|