C16H19IN4O — CID 111354529
1-[(4-cyanophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111354529) has the molecular formula C16H19IN4O and a molecular weight of 410.26 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111354529 |
| Molecular Formula | C16H19IN4O |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccco1)NCc1ccc(C#N)cc1.I |
| InChI | InChI=1S/C16H18N4O.HI/c1-18-16(19-9-8-15-3-2-10-21-15)20-12-14-6-4-13(11-17)5-7-14;/h2-7,10H,8-9,12H2,1H3,(H2,18,19,20);1H |
| InChIKey | FDEBBXUIFLJZML-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|