C20H26IN5O2 — CID 111354265
1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111354265) has the molecular formula C20H26IN5O2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111354265 |
| Molecular Formula | C20H26IN5O2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1noc(-c2ccc(CCN/C(=N/C)NCCc3ccco3)cc2)n1.I |
| InChI | InChI=1S/C20H25N5O2.HI/c1-3-18-24-19(27-25-18)16-8-6-15(7-9-16)10-12-22-20(21-2)23-13-11-17-5-4-14-26-17;/h4-9,14H,3,10-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | ZMFSSOQOLZBPJK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|