C17H19Cl3N4O — CID 109464450
2-methyl-1-(2-pyridin-2-ylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine (PubChem CID 109464450) has the molecular formula C17H19Cl3N4O and a molecular weight of 401.73 g/mol. Its IUPAC name is 2-methyl-1-(2-pyridin-2-ylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine.
| Compound Name | 2-methyl-1-(2-pyridin-2-ylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 109464450 |
| Molecular Formula | C17H19Cl3N4O |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-methyl-1-(2-pyridin-2-ylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
| SMILES | C/N=C(/NCCOc1c(Cl)cc(Cl)cc1Cl)NCCc1ccccn1 |
| InChI | InChI=1S/C17H19Cl3N4O/c1-21-17(23-7-5-13-4-2-3-6-22-13)24-8-9-25-16-14(19)10-12(18)11-15(16)20/h2-4,6,10-11H,5,7-9H2,1H3,(H2,21,23,24) |
| InChIKey | PLHSWUAXXGQDHP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|