C16H20Cl2N6 — CID 111191174
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111191174) has the molecular formula C16H20Cl2N6 and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111191174 |
| Molecular Formula | C16H20Cl2N6 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCNc1ncc(Cl)cc1Cl)NCCc1ccccn1 |
| InChI | InChI=1S/C16H20Cl2N6/c1-19-16(22-7-5-13-4-2-3-6-20-13)23-9-8-21-15-14(18)10-12(17)11-24-15/h2-4,6,10-11H,5,7-9H2,1H3,(H,21,24)(H2,19,22,23) |
| InChIKey | MFFINTCVVPHPMY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|