C16H20Cl2IN5 — CID 110953157
1-benzyl-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110953157) has the molecular formula C16H20Cl2IN5 and a molecular weight of 480.18 g/mol. Its IUPAC name is 1-benzyl-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110953157 |
| Molecular Formula | C16H20Cl2IN5 |
| Molecular Weight | 480.18 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 1-benzyl-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncc(Cl)cc1Cl)NCc1ccccc1.I |
| InChI | InChI=1S/C16H19Cl2N5.HI/c1-19-16(23-10-12-5-3-2-4-6-12)21-8-7-20-15-14(18)9-13(17)11-22-15;/h2-6,9,11H,7-8,10H2,1H3,(H,20,22)(H2,19,21,23);1H |
| InChIKey | VITFCWFWYVBLLV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.18 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|