C12H17Cl2N3O2 — CID 115697235
tert-butyl N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]carbamate (PubChem CID 115697235) has the molecular formula C12H17Cl2N3O2 and a molecular weight of 306.19 g/mol. Its IUPAC name is tert-butyl N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 115697235 |
| Molecular Formula | C12H17Cl2N3O2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | tert-butyl N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O2/c1-12(2,3)19-11(18)16-5-4-15-10-9(14)6-8(13)7-17-10/h6-7H,4-5H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | IIHFHSFHSUFYSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|